C29H31NO3 — CID 122644332
5,8-dideuterio-2-[3,5-dideuterio-4-[[1-(1,1,2,2,3,3,3-heptadeuteriopropyl)azetidin-3-yl]methyl]phenyl]-3-(4-hydroxyphenyl)-4-(trideuteriomethyl)-2H-chromen-7-ol (PubChem CID 122644332) has the molecular formula C29H31NO3 and a molecular weight of 455.66 g/mol. Its IUPAC name is 5,8-dideuterio-2-[3,5-dideuterio-4-[[1-(1,1,2,2,3,3,3-heptadeuteriopropyl)azetidin-3-yl]methyl]phenyl]-3-(4-hydroxyphenyl)-4-(trideuteriomethyl)-2H-chromen-7-ol.
| Compound Name | 5,8-dideuterio-2-[3,5-dideuterio-4-[[1-(1,1,2,2,3,3,3-heptadeuteriopropyl)azetidin-3-yl]methyl]phenyl]-3-(4-hydroxyphenyl)-4-(trideuteriomethyl)-2H-chromen-7-ol |
|---|---|
| PubChem CID | 122644332 |
| Molecular Formula | C29H31NO3 |
| Molecular Weight | 455.66 g/mol |
| Exact Mass | 455.32 |
| IUPAC Name | 5,8-dideuterio-2-[3,5-dideuterio-4-[[1-(1,1,2,2,3,3,3-heptadeuteriopropyl)azetidin-3-yl]methyl]phenyl]-3-(4-hydroxyphenyl)-4-(trideuteriomethyl)-2H-chromen-7-ol |
| SMILES | [2H]c1cc(C2Oc3c([2H])c(O)cc([2H])c3C(C([2H])([2H])[2H])=C2c2ccc(O)cc2)cc([2H])c1CC1CN(C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])C1 |
| InChI | InChI=1S/C29H31NO3/c1-3-14-30-17-21(18-30)15-20-4-6-23(7-5-20)29-28(22-8-10-24(31)11-9-22)19(2)26-13-12-25(32)16-27(26)33-29/h4-13,16,21,29,31-32H,3,14-15,17-18H2,1-2H3/i1D3,2D3,3D2,4D,5D,13D,14D2,16D |
| InChIKey | MKWRINCSXMVUPV-JYWKQRHNSA-N |
| XLogP | 6.05 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.66 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|