C28H29NO3S — CID 122644347
5-deuterio-2-[3,5-dideuterio-4-[1-(1,1,2,2,3,3,3-heptadeuteriopropyl)azetidin-3-yl]sulfanylphenyl]-3-(4-hydroxyphenyl)-4-(trideuteriomethyl)-2H-chromen-7-ol (PubChem CID 122644347) has the molecular formula C28H29NO3S and a molecular weight of 472.69 g/mol. Its IUPAC name is 5-deuterio-2-[3,5-dideuterio-4-[1-(1,1,2,2,3,3,3-heptadeuteriopropyl)azetidin-3-yl]sulfanylphenyl]-3-(4-hydroxyphenyl)-4-(trideuteriomethyl)-2H-chromen-7-ol.
| Compound Name | 5-deuterio-2-[3,5-dideuterio-4-[1-(1,1,2,2,3,3,3-heptadeuteriopropyl)azetidin-3-yl]sulfanylphenyl]-3-(4-hydroxyphenyl)-4-(trideuteriomethyl)-2H-chromen-7-ol |
|---|---|
| PubChem CID | 122644347 |
| Molecular Formula | C28H29NO3S |
| Molecular Weight | 472.69 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | 5-deuterio-2-[3,5-dideuterio-4-[1-(1,1,2,2,3,3,3-heptadeuteriopropyl)azetidin-3-yl]sulfanylphenyl]-3-(4-hydroxyphenyl)-4-(trideuteriomethyl)-2H-chromen-7-ol |
| SMILES | [2H]c1cc(C2Oc3cc(O)cc([2H])c3C(C([2H])([2H])[2H])=C2c2ccc(O)cc2)cc([2H])c1SC1CN(C([2H])([2H])C([2H])([2H])C([2H])([2H])[2H])C1 |
| InChI | InChI=1S/C28H29NO3S/c1-3-14-29-16-24(17-29)33-23-11-6-20(7-12-23)28-27(19-4-8-21(30)9-5-19)18(2)25-13-10-22(31)15-26(25)32-28/h4-13,15,24,28,30-31H,3,14,16-17H2,1-2H3/i1D3,2D3,3D2,11D,12D,13D,14D2 |
| InChIKey | IQMADZCUMYYSJV-SZTGYHRKSA-N |
| XLogP | 6.35 |
| TPSA | 52.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.69 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|