C26H52O2 — CID 122644760
2-(5,5-dimethylhexyl)-4,6-diheptyl-1,3-dioxane (PubChem CID 122644760) has the molecular formula C26H52O2 and a molecular weight of 396.70 g/mol. Its IUPAC name is 2-(5,5-dimethylhexyl)-4,6-diheptyl-1,3-dioxane.
| Compound Name | 2-(5,5-dimethylhexyl)-4,6-diheptyl-1,3-dioxane |
|---|---|
| PubChem CID | 122644760 |
| Molecular Formula | C26H52O2 |
| Molecular Weight | 396.70 g/mol |
| Exact Mass | 396.40 |
| IUPAC Name | 2-(5,5-dimethylhexyl)-4,6-diheptyl-1,3-dioxane |
| SMILES | CCCCCCCC1CC(CCCCCCC)OC(CCCCC(C)(C)C)O1 |
| InChI | InChI=1S/C26H52O2/c1-6-8-10-12-14-18-23-22-24(19-15-13-11-9-7-2)28-25(27-23)20-16-17-21-26(3,4)5/h23-25H,6-22H2,1-5H3 |
| InChIKey | YKVJZSNGSNRWFQ-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.70 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|