C13H28N2 — CID 122645241
1-butan-2-yl-4-(2,2-dimethylpropyl)piperazine (PubChem CID 122645241) has the molecular formula C13H28N2 and a molecular weight of 212.38 g/mol. Its IUPAC name is 1-butan-2-yl-4-(2,2-dimethylpropyl)piperazine.
| Compound Name | 1-butan-2-yl-4-(2,2-dimethylpropyl)piperazine |
|---|---|
| PubChem CID | 122645241 |
| Molecular Formula | C13H28N2 |
| Molecular Weight | 212.38 g/mol |
| Exact Mass | 212.23 |
| IUPAC Name | 1-butan-2-yl-4-(2,2-dimethylpropyl)piperazine |
| SMILES | CCC(C)N1CCN(CC(C)(C)C)CC1 |
| InChI | InChI=1S/C13H28N2/c1-6-12(2)15-9-7-14(8-10-15)11-13(3,4)5/h12H,6-11H2,1-5H3 |
| InChIKey | MCCRWJUMUZAHNI-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |