C35H35BrF4N2O+2 — CID 122646413
(R)-[1-[(4-bromo-2-fluorophenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-[1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]quinolin-1-ium-4-yl]methanol (PubChem CID 122646413) has the molecular formula C35H35BrF4N2O+2 and a molecular weight of 655.57 g/mol. Its IUPAC name is (R)-[1-[(4-bromo-2-fluorophenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-[1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]quinolin-1-ium-4-yl]methanol.
| Compound Name | (R)-[1-[(4-bromo-2-fluorophenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-[1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]quinolin-1-ium-4-yl]methanol |
|---|---|
| PubChem CID | 122646413 |
| Molecular Formula | C35H35BrF4N2O+2 |
| Molecular Weight | 655.57 g/mol |
| Exact Mass | 654.19 |
| IUPAC Name | (R)-[1-[(4-bromo-2-fluorophenyl)methyl]-5-ethenyl-1-azoniabicyclo[2.2.2]octan-2-yl]-[1-[[3-methyl-5-(trifluoromethyl)phenyl]methyl]quinolin-1-ium-4-yl]methanol |
| SMILES | C=CC1C[N+]2(Cc3ccc(Br)cc3F)CCC1CC2[C@H](O)c1cc[n+](Cc2cc(C)cc(C(F)(F)F)c2)c2ccccc12 |
| InChI | InChI=1S/C35H35BrF4N2O/c1-3-24-20-42(21-26-8-9-28(36)18-31(26)37)13-11-25(24)17-33(42)34(43)30-10-12-41(32-7-5-4-6-29(30)32)19-23-14-22(2)15-27(16-23)35(38,39)40/h3-10,12,14-16,18,24-25,33-34,43H,1,11,13,17,19-21H2,2H3/q+2/t24?,25?,33?,34-,42?/m1/s1 |
| InChIKey | JVCRWPOYRLBSIY-PVIBNKHSSA-N |
| XLogP | 8.05 |
| TPSA | 24.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.57 |
| LogP ≤ 5 | 8.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|