C8H10F3NS — CID 122646718
5-tert-butyl-2-(trifluoromethyl)-1,3-thiazole (PubChem CID 122646718) has the molecular formula C8H10F3NS and a molecular weight of 209.24 g/mol. Its IUPAC name is 5-tert-butyl-2-(trifluoromethyl)-1,3-thiazole.
| Compound Name | 5-tert-butyl-2-(trifluoromethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 122646718 |
| Molecular Formula | C8H10F3NS |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.05 |
| IUPAC Name | 5-tert-butyl-2-(trifluoromethyl)-1,3-thiazole |
| SMILES | CC(C)(C)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C8H10F3NS/c1-7(2,3)5-4-12-6(13-5)8(9,10)11/h4H,1-3H3 |
| InChIKey | LFLFJLPUDXYICA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |