About 2-tert-butyl-5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine
2-tert-butyl-5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine (PubChem CID 122646722) has the molecular formula C12H21N3
and a molecular weight of 207.32 g/mol. Its IUPAC name is 2-tert-butyl-5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine.
Molecular Properties
| Compound Name | 2-tert-butyl-5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
| PubChem CID | 122646722 |
| Molecular Formula | C12H21N3 |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.17 |
| IUPAC Name | 2-tert-butyl-5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine |
| SMILES | CCN1CCn2nc(C(C)(C)C)cc2C1 |
| InChI | InChI=1S/C12H21N3/c1-5-14-6-7-15-10(9-14)8-11(13-15)12(2,3)4/h8H,5-7,9H2,1-4H3 |
| InChIKey | UAZYLQPZHPXCAP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-tert-butyl-5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine?
The IUPAC name of 2-tert-butyl-5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine (CID 122646722) is 2-tert-butyl-5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine.
What is the SMILES notation for 2-tert-butyl-5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine?
The canonical SMILES for 2-tert-butyl-5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine is CCN1CCn2nc(C(C)(C)C)cc2C1.
What is the InChIKey of 2-tert-butyl-5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine?
The InChIKey is UAZYLQPZHPXCAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3/c1-5-14-6-7-15-10(9-14)8-11(13-15)12(2,3)4/h8H,5-7,9H2,1-4H3.
What are the key properties of 2-tert-butyl-5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine?
2-tert-butyl-5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine has a molecular weight of 207.32 g/mol, XLogP of 2.02, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5-ethyl-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine is sourced from PubChem (CID 122646722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).