C35H45N9O6 — CID 122646900
tert-butyl N-[6-(6-aminopyrazin-2-yl)imidazo[1,2-a]pyrazin-8-yl]-N-[3-[2-(oxan-2-yloxy)ethoxy]-4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]carbamate (PubChem CID 122646900) has the molecular formula C35H45N9O6 and a molecular weight of 687.80 g/mol. Its IUPAC name is tert-butyl N-[6-(6-aminopyrazin-2-yl)imidazo[1,2-a]pyrazin-8-yl]-N-[3-[2-(oxan-2-yloxy)ethoxy]-4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]carbamate.
| Compound Name | tert-butyl N-[6-(6-aminopyrazin-2-yl)imidazo[1,2-a]pyrazin-8-yl]-N-[3-[2-(oxan-2-yloxy)ethoxy]-4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]carbamate |
|---|---|
| PubChem CID | 122646900 |
| Molecular Formula | C35H45N9O6 |
| Molecular Weight | 687.80 g/mol |
| Exact Mass | 687.35 |
| IUPAC Name | tert-butyl N-[6-(6-aminopyrazin-2-yl)imidazo[1,2-a]pyrazin-8-yl]-N-[3-[2-(oxan-2-yloxy)ethoxy]-4-[4-(oxetan-3-yl)piperazin-1-yl]phenyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(c1ccc(N2CCN(C3COC3)CC2)c(OCCOC2CCCCO2)c1)c1nc(-c2cncc(N)n2)cn2ccnc12 |
| InChI | InChI=1S/C35H45N9O6/c1-35(2,3)50-34(45)44(33-32-38-9-10-43(32)21-27(40-33)26-19-37-20-30(36)39-26)24-7-8-28(42-13-11-41(12-14-42)25-22-46-23-25)29(18-24)47-16-17-49-31-6-4-5-15-48-31/h7-10,18-21,25,31H,4-6,11-17,22-23H2,1-3H3,(H2,36,39) |
| InChIKey | XMIIBEKONKDQME-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 154.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.80 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|