C6H7Cl2N — CID 122647090
N-[(1E,3E)-2,4-dichlorobuta-1,3-dienyl]ethanimine (PubChem CID 122647090) has the molecular formula C6H7Cl2N and a molecular weight of 164.03 g/mol. Its IUPAC name is N-[(1E,3E)-2,4-dichlorobuta-1,3-dienyl]ethanimine.
| Compound Name | N-[(1E,3E)-2,4-dichlorobuta-1,3-dienyl]ethanimine |
|---|---|
| PubChem CID | 122647090 |
| Molecular Formula | C6H7Cl2N |
| Molecular Weight | 164.03 g/mol |
| Exact Mass | 163.00 |
| IUPAC Name | N-[(1E,3E)-2,4-dichlorobuta-1,3-dienyl]ethanimine |
| SMILES | C/C=N/C=C(Cl)\C=C\Cl |
| InChI | InChI=1S/C6H7Cl2N/c1-2-9-5-6(8)3-4-7/h2-5H,1H3/b4-3+,6-5+,9-2+ |
| InChIKey | QWGLHMIJNZZIDB-HTNIGEPASA-N |
| XLogP | 2.91 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.03 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|