C32H16F6O7 — CID 122647224
5-[4-[2-[4-(1,3-dioxoinden-5-yl)oxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-2-benzofuran-1,3-dione (PubChem CID 122647224) has the molecular formula C32H16F6O7 and a molecular weight of 626.46 g/mol. Its IUPAC name is 5-[4-[2-[4-(1,3-dioxoinden-5-yl)oxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-2-benzofuran-1,3-dione.
| Compound Name | 5-[4-[2-[4-(1,3-dioxoinden-5-yl)oxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 122647224 |
| Molecular Formula | C32H16F6O7 |
| Molecular Weight | 626.46 g/mol |
| Exact Mass | 626.08 |
| IUPAC Name | 5-[4-[2-[4-(1,3-dioxoinden-5-yl)oxyphenyl]-1,1,1,3,3,3-hexafluoropropan-2-yl]phenoxy]-2-benzofuran-1,3-dione |
| SMILES | O=C1CC(=O)c2cc(Oc3ccc(C(c4ccc(Oc5ccc6c(c5)C(=O)OC6=O)cc4)(C(F)(F)F)C(F)(F)F)cc3)ccc21 |
| InChI | InChI=1S/C32H16F6O7/c33-31(34,35)30(32(36,37)38,16-1-5-18(6-2-16)43-20-9-11-22-24(13-20)27(40)15-26(22)39)17-3-7-19(8-4-17)44-21-10-12-23-25(14-21)29(42)45-28(23)41/h1-14H,15H2 |
| InChIKey | UFOVUGXFNYMMFA-UHFFFAOYSA-N |
| XLogP | 7.76 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.46 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'keto_keto_beta_A(68)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|