C40H44N4O6 — CID 122647392
(E)-N,N'-bis[(2S)-1-(4-methoxy-N-methylanilino)-1-oxo-3-phenylpropan-2-yl]-3-methylpent-2-enediamide (PubChem CID 122647392) has the molecular formula C40H44N4O6 and a molecular weight of 676.81 g/mol. Its IUPAC name is (E)-N,N'-bis[(2S)-1-(4-methoxy-N-methylanilino)-1-oxo-3-phenylpropan-2-yl]-3-methylpent-2-enediamide.
| Compound Name | (E)-N,N'-bis[(2S)-1-(4-methoxy-N-methylanilino)-1-oxo-3-phenylpropan-2-yl]-3-methylpent-2-enediamide |
|---|---|
| PubChem CID | 122647392 |
| Molecular Formula | C40H44N4O6 |
| Molecular Weight | 676.81 g/mol |
| Exact Mass | 676.33 |
| IUPAC Name | (E)-N,N'-bis[(2S)-1-(4-methoxy-N-methylanilino)-1-oxo-3-phenylpropan-2-yl]-3-methylpent-2-enediamide |
| SMILES | COc1ccc(N(C)C(=O)[C@H](Cc2ccccc2)NC(=O)/C=C(\C)CC(=O)N[C@@H](Cc2ccccc2)C(=O)N(C)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C40H44N4O6/c1-28(24-37(45)41-35(26-29-12-8-6-9-13-29)39(47)43(2)31-16-20-33(49-4)21-17-31)25-38(46)42-36(27-30-14-10-7-11-15-30)40(48)44(3)32-18-22-34(50-5)23-19-32/h6-24,35-36H,25-27H2,1-5H3,(H,41,45)(H,42,46)/b28-24+/t35-,36-/m0/s1 |
| InChIKey | KVZQJTYULGPYTK-IWCYHKRBSA-N |
| XLogP | 5.12 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.81 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|