About N-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine
N-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine (PubChem CID 122647417) has the molecular formula C7H7N3S
and a molecular weight of 165.22 g/mol. Its IUPAC name is N-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine.
Molecular Properties
| Compound Name | N-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine |
| PubChem CID | 122647417 |
| Molecular Formula | C7H7N3S |
| Molecular Weight | 165.22 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | N-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine |
| SMILES | CNc1cnc2scnc2c1 |
| InChI | InChI=1S/C7H7N3S/c1-8-5-2-6-7(9-3-5)11-4-10-6/h2-4,8H,1H3 |
| InChIKey | JBKFABBCRMVROF-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine?
The IUPAC name of N-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine (CID 122647417) is N-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine.
What is the SMILES notation for N-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine?
The canonical SMILES for N-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine is CNc1cnc2scnc2c1.
What is the InChIKey of N-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine?
The InChIKey is JBKFABBCRMVROF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3S/c1-8-5-2-6-7(9-3-5)11-4-10-6/h2-4,8H,1H3.
What are the key properties of N-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine?
N-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine has a molecular weight of 165.22 g/mol, XLogP of 1.73, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-[1,3]thiazolo[5,4-b]pyridin-6-amine is sourced from PubChem (CID 122647417), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).