About (2S)-2-amino-3-(3,5-difluorophenyl)-N-prop-2-enyl-N-quinoxalin-6-ylpropanamide
(2S)-2-amino-3-(3,5-difluorophenyl)-N-prop-2-enyl-N-quinoxalin-6-ylpropanamide (PubChem CID 122647442) has the molecular formula C20H18F2N4O
and a molecular weight of 368.39 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,5-difluorophenyl)-N-prop-2-enyl-N-quinoxalin-6-ylpropanamide.
Molecular Properties
| Compound Name | (2S)-2-amino-3-(3,5-difluorophenyl)-N-prop-2-enyl-N-quinoxalin-6-ylpropanamide |
| PubChem CID | 122647442 |
| Molecular Formula | C20H18F2N4O |
| Molecular Weight | 368.39 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | (2S)-2-amino-3-(3,5-difluorophenyl)-N-prop-2-enyl-N-quinoxalin-6-ylpropanamide |
| SMILES | C=CCN(C(=O)[C@@H](N)Cc1cc(F)cc(F)c1)c1ccc2nccnc2c1 |
| InChI | InChI=1S/C20H18F2N4O/c1-2-7-26(16-3-4-18-19(12-16)25-6-5-24-18)20(27)17(23)10-13-8-14(21)11-15(22)9-13/h2-6,8-9,11-12,17H,1,7,10,23H2/t17-/m0/s1 |
| InChIKey | CWNSRUJDTKNSDK-KRWDZBQOSA-N |
| XLogP | 3.00 |
| TPSA | 72.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.39 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-3-(3,5-difluorophenyl)-N-prop-2-enyl-N-quinoxalin-6-ylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3-(3,5-difluorophenyl)-N-prop-2-enyl-N-quinoxalin-6-ylpropanamide?
The IUPAC name of (2S)-2-amino-3-(3,5-difluorophenyl)-N-prop-2-enyl-N-quinoxalin-6-ylpropanamide (CID 122647442) is (2S)-2-amino-3-(3,5-difluorophenyl)-N-prop-2-enyl-N-quinoxalin-6-ylpropanamide.
What is the SMILES notation for (2S)-2-amino-3-(3,5-difluorophenyl)-N-prop-2-enyl-N-quinoxalin-6-ylpropanamide?
The canonical SMILES for (2S)-2-amino-3-(3,5-difluorophenyl)-N-prop-2-enyl-N-quinoxalin-6-ylpropanamide is C=CCN(C(=O)[C@@H](N)Cc1cc(F)cc(F)c1)c1ccc2nccnc2c1.
What is the InChIKey of (2S)-2-amino-3-(3,5-difluorophenyl)-N-prop-2-enyl-N-quinoxalin-6-ylpropanamide?
The InChIKey is CWNSRUJDTKNSDK-KRWDZBQOSA-N. The full InChI is InChI=1S/C20H18F2N4O/c1-2-7-26(16-3-4-18-19(12-16)25-6-5-24-18)20(27)17(23)10-13-8-14(21)11-15(22)9-13/h2-6,8-9,11-12,17H,1,7,10,23H2/t17-/m0/s1.
What are the key properties of (2S)-2-amino-3-(3,5-difluorophenyl)-N-prop-2-enyl-N-quinoxalin-6-ylpropanamide?
(2S)-2-amino-3-(3,5-difluorophenyl)-N-prop-2-enyl-N-quinoxalin-6-ylpropanamide has a molecular weight of 368.39 g/mol, XLogP of 3.00, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-(3,5-difluorophenyl)-N-prop-2-enyl-N-quinoxalin-6-ylpropanamide is sourced from PubChem (CID 122647442), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).