About 5-[[4-(hydroxymethyl)phenyl]methyl]-1,2-oxazol-3-one
5-[[4-(hydroxymethyl)phenyl]methyl]-1,2-oxazol-3-one (PubChem CID 122647670) has the molecular formula C11H11NO3
and a molecular weight of 205.21 g/mol. Its IUPAC name is 5-[[4-(hydroxymethyl)phenyl]methyl]-1,2-oxazol-3-one.
Molecular Properties
| Compound Name | 5-[[4-(hydroxymethyl)phenyl]methyl]-1,2-oxazol-3-one |
| PubChem CID | 122647670 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 5-[[4-(hydroxymethyl)phenyl]methyl]-1,2-oxazol-3-one |
| SMILES | O=c1cc(Cc2ccc(CO)cc2)o[nH]1 |
| InChI | InChI=1S/C11H11NO3/c13-7-9-3-1-8(2-4-9)5-10-6-11(14)12-15-10/h1-4,6,13H,5,7H2,(H,12,14) |
| InChIKey | DHFGULJJFKMBIK-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-[[4-(hydroxymethyl)phenyl]methyl]-1,2-oxazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[[4-(hydroxymethyl)phenyl]methyl]-1,2-oxazol-3-one?
The IUPAC name of 5-[[4-(hydroxymethyl)phenyl]methyl]-1,2-oxazol-3-one (CID 122647670) is 5-[[4-(hydroxymethyl)phenyl]methyl]-1,2-oxazol-3-one.
What is the SMILES notation for 5-[[4-(hydroxymethyl)phenyl]methyl]-1,2-oxazol-3-one?
The canonical SMILES for 5-[[4-(hydroxymethyl)phenyl]methyl]-1,2-oxazol-3-one is O=c1cc(Cc2ccc(CO)cc2)o[nH]1.
What is the InChIKey of 5-[[4-(hydroxymethyl)phenyl]methyl]-1,2-oxazol-3-one?
The InChIKey is DHFGULJJFKMBIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3/c13-7-9-3-1-8(2-4-9)5-10-6-11(14)12-15-10/h1-4,6,13H,5,7H2,(H,12,14).
What are the key properties of 5-[[4-(hydroxymethyl)phenyl]methyl]-1,2-oxazol-3-one?
5-[[4-(hydroxymethyl)phenyl]methyl]-1,2-oxazol-3-one has a molecular weight of 205.21 g/mol, XLogP of 1.05, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[[4-(hydroxymethyl)phenyl]methyl]-1,2-oxazol-3-one is sourced from PubChem (CID 122647670), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).