C23H24N2O2S2 — CID 122647713
(3R,6S)-6-ethyl-3,6-dimethyl-1,1-dioxo-3-(8-prop-1-ynyldibenzothiophen-2-yl)-2H-1,4-thiazin-5-amine (PubChem CID 122647713) has the molecular formula C23H24N2O2S2 and a molecular weight of 424.59 g/mol. Its IUPAC name is (3R,6S)-6-ethyl-3,6-dimethyl-1,1-dioxo-3-(8-prop-1-ynyldibenzothiophen-2-yl)-2H-1,4-thiazin-5-amine.
| Compound Name | (3R,6S)-6-ethyl-3,6-dimethyl-1,1-dioxo-3-(8-prop-1-ynyldibenzothiophen-2-yl)-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 122647713 |
| Molecular Formula | C23H24N2O2S2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | (3R,6S)-6-ethyl-3,6-dimethyl-1,1-dioxo-3-(8-prop-1-ynyldibenzothiophen-2-yl)-2H-1,4-thiazin-5-amine |
| SMILES | CC#Cc1ccc2sc3ccc([C@]4(C)CS(=O)(=O)[C@@](C)(CC)C(N)=N4)cc3c2c1 |
| InChI | InChI=1S/C23H24N2O2S2/c1-5-7-15-8-10-19-17(12-15)18-13-16(9-11-20(18)28-19)22(3)14-29(26,27)23(4,6-2)21(24)25-22/h8-13H,6,14H2,1-4H3,(H2,24,25)/t22-,23-/m0/s1 |
| InChIKey | ZTVXCMUHYKRGOF-GOTSBHOMSA-N |
| XLogP | 4.60 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|