C24H24N2O2S — CID 122647714
(2R,3S,6R)-2,6-dimethyl-4,4-dioxo-6-(6-prop-1-ynyl-9H-fluoren-3-yl)-4λ6-thia-7-azaspiro[2.5]oct-7-en-8-amine (PubChem CID 122647714) has the molecular formula C24H24N2O2S and a molecular weight of 404.54 g/mol. Its IUPAC name is (2R,3S,6R)-2,6-dimethyl-4,4-dioxo-6-(6-prop-1-ynyl-9H-fluoren-3-yl)-4λ6-thia-7-azaspiro[2.5]oct-7-en-8-amine.
| Compound Name | (2R,3S,6R)-2,6-dimethyl-4,4-dioxo-6-(6-prop-1-ynyl-9H-fluoren-3-yl)-4λ6-thia-7-azaspiro[2.5]oct-7-en-8-amine |
|---|---|
| PubChem CID | 122647714 |
| Molecular Formula | C24H24N2O2S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.16 |
| IUPAC Name | (2R,3S,6R)-2,6-dimethyl-4,4-dioxo-6-(6-prop-1-ynyl-9H-fluoren-3-yl)-4λ6-thia-7-azaspiro[2.5]oct-7-en-8-amine |
| SMILES | CC#Cc1ccc2c(c1)-c1cc([C@]3(C)CS(=O)(=O)[C@]4(C[C@H]4C)C(N)=N3)ccc1C2 |
| InChI | InChI=1S/C24H24N2O2S/c1-4-5-16-6-7-17-11-18-8-9-19(12-21(18)20(17)10-16)23(3)14-29(27,28)24(13-15(24)2)22(25)26-23/h6-10,12,15H,11,13-14H2,1-3H3,(H2,25,26)/t15-,23+,24+/m1/s1 |
| InChIKey | ASRSCODUWIXHCZ-BDJFWFNGSA-N |
| XLogP | 3.41 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|