C21H16F3N3OS — CID 122647715
(6S)-2-amino-3,6-dimethyl-6-[8-(3,3,3-trifluoroprop-1-ynyl)dibenzothiophen-2-yl]-5H-pyrimidin-4-one (PubChem CID 122647715) has the molecular formula C21H16F3N3OS and a molecular weight of 415.44 g/mol. Its IUPAC name is (6S)-2-amino-3,6-dimethyl-6-[8-(3,3,3-trifluoroprop-1-ynyl)dibenzothiophen-2-yl]-5H-pyrimidin-4-one.
| Compound Name | (6S)-2-amino-3,6-dimethyl-6-[8-(3,3,3-trifluoroprop-1-ynyl)dibenzothiophen-2-yl]-5H-pyrimidin-4-one |
|---|---|
| PubChem CID | 122647715 |
| Molecular Formula | C21H16F3N3OS |
| Molecular Weight | 415.44 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | (6S)-2-amino-3,6-dimethyl-6-[8-(3,3,3-trifluoroprop-1-ynyl)dibenzothiophen-2-yl]-5H-pyrimidin-4-one |
| SMILES | CN1C(=O)C[C@@](C)(c2ccc3sc4ccc(C#CC(F)(F)F)cc4c3c2)N=C1N |
| InChI | InChI=1S/C21H16F3N3OS/c1-20(11-18(28)27(2)19(25)26-20)13-4-6-17-15(10-13)14-9-12(3-5-16(14)29-17)7-8-21(22,23)24/h3-6,9-10H,11H2,1-2H3,(H2,25,26)/t20-/m0/s1 |
| InChIKey | DALQENJDZFCNJQ-FQEVSTJZSA-N |
| XLogP | 4.36 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|