About 8-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]dibenzothiophene-2-carbonitrile
8-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]dibenzothiophene-2-carbonitrile (PubChem CID 122647716) has the molecular formula C19H16N4OS
and a molecular weight of 348.43 g/mol. Its IUPAC name is 8-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]dibenzothiophene-2-carbonitrile.
Molecular Properties
| Compound Name | 8-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]dibenzothiophene-2-carbonitrile |
| PubChem CID | 122647716 |
| Molecular Formula | C19H16N4OS |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 8-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]dibenzothiophene-2-carbonitrile |
| SMILES | CN1C(=O)C[C@@](C)(c2ccc3sc4ccc(C#N)cc4c3c2)N=C1N |
| InChI | InChI=1S/C19H16N4OS/c1-19(9-17(24)23(2)18(21)22-19)12-4-6-16-14(8-12)13-7-11(10-20)3-5-15(13)25-16/h3-8H,9H2,1-2H3,(H2,21,22)/t19-/m0/s1 |
| InChIKey | VGOAETJNCUTHJV-IBGZPJMESA-N |
| XLogP | 3.32 |
| TPSA | 82.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]dibenzothiophene-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]dibenzothiophene-2-carbonitrile?
The IUPAC name of 8-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]dibenzothiophene-2-carbonitrile (CID 122647716) is 8-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]dibenzothiophene-2-carbonitrile.
What is the SMILES notation for 8-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]dibenzothiophene-2-carbonitrile?
The canonical SMILES for 8-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]dibenzothiophene-2-carbonitrile is CN1C(=O)C[C@@](C)(c2ccc3sc4ccc(C#N)cc4c3c2)N=C1N.
What is the InChIKey of 8-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]dibenzothiophene-2-carbonitrile?
The InChIKey is VGOAETJNCUTHJV-IBGZPJMESA-N. The full InChI is InChI=1S/C19H16N4OS/c1-19(9-17(24)23(2)18(21)22-19)12-4-6-16-14(8-12)13-7-11(10-20)3-5-15(13)25-16/h3-8H,9H2,1-2H3,(H2,21,22)/t19-/m0/s1.
What are the key properties of 8-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]dibenzothiophene-2-carbonitrile?
8-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]dibenzothiophene-2-carbonitrile has a molecular weight of 348.43 g/mol, XLogP of 3.32, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(4S)-2-amino-1,4-dimethyl-6-oxo-5H-pyrimidin-4-yl]dibenzothiophene-2-carbonitrile is sourced from PubChem (CID 122647716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).