C19H23N5O3S — CID 122647724
(3R)-3-[2-(2,4-dimethyl-1,3-oxazol-5-yl)indazol-5-yl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine (PubChem CID 122647724) has the molecular formula C19H23N5O3S and a molecular weight of 401.49 g/mol. Its IUPAC name is (3R)-3-[2-(2,4-dimethyl-1,3-oxazol-5-yl)indazol-5-yl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine.
| Compound Name | (3R)-3-[2-(2,4-dimethyl-1,3-oxazol-5-yl)indazol-5-yl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 122647724 |
| Molecular Formula | C19H23N5O3S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | (3R)-3-[2-(2,4-dimethyl-1,3-oxazol-5-yl)indazol-5-yl]-3,6,6-trimethyl-1,1-dioxo-2H-1,4-thiazin-5-amine |
| SMILES | Cc1nc(C)c(-n2cc3cc([C@]4(C)CS(=O)(=O)C(C)(C)C(N)=N4)ccc3n2)o1 |
| InChI | InChI=1S/C19H23N5O3S/c1-11-16(27-12(2)21-11)24-9-13-8-14(6-7-15(13)23-24)19(5)10-28(25,26)18(3,4)17(20)22-19/h6-9H,10H2,1-5H3,(H2,20,22)/t19-/m0/s1 |
| InChIKey | ONYARWWZRBUQFJ-IBGZPJMESA-N |
| XLogP | 2.41 |
| TPSA | 116.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |