C24H24N2O3S2 — CID 122647778
(3R,6S)-3,6-dimethyl-6-(oxetan-3-yl)-1,1-dioxo-3-(8-prop-1-ynyldibenzothiophen-2-yl)-2H-1,4-thiazin-5-amine (PubChem CID 122647778) has the molecular formula C24H24N2O3S2 and a molecular weight of 452.60 g/mol. Its IUPAC name is (3R,6S)-3,6-dimethyl-6-(oxetan-3-yl)-1,1-dioxo-3-(8-prop-1-ynyldibenzothiophen-2-yl)-2H-1,4-thiazin-5-amine.
| Compound Name | (3R,6S)-3,6-dimethyl-6-(oxetan-3-yl)-1,1-dioxo-3-(8-prop-1-ynyldibenzothiophen-2-yl)-2H-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 122647778 |
| Molecular Formula | C24H24N2O3S2 |
| Molecular Weight | 452.60 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | (3R,6S)-3,6-dimethyl-6-(oxetan-3-yl)-1,1-dioxo-3-(8-prop-1-ynyldibenzothiophen-2-yl)-2H-1,4-thiazin-5-amine |
| SMILES | CC#Cc1ccc2sc3ccc([C@]4(C)CS(=O)(=O)[C@@](C)(C5COC5)C(N)=N4)cc3c2c1 |
| InChI | InChI=1S/C24H24N2O3S2/c1-4-5-15-6-8-20-18(10-15)19-11-16(7-9-21(19)30-20)23(2)14-31(27,28)24(3,22(25)26-23)17-12-29-13-17/h6-11,17H,12-14H2,1-3H3,(H2,25,26)/t23-,24-/m0/s1 |
| InChIKey | BXMPNMIAORKBLR-ZEQRLZLVSA-N |
| XLogP | 3.83 |
| TPSA | 81.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.60 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|