C25H37ClO5 — CID 122648045
3-(chloromethyl)-3-hydroxy-9-methyl-4,8-bis(3-methylbut-2-enoxy)-6-methylidene-4,5,6a,7,8,9,9a,9b-octahydro-3aH-azuleno[4,5-b]furan-2-one (PubChem CID 122648045) has the molecular formula C25H37ClO5 and a molecular weight of 453.02 g/mol. Its IUPAC name is 3-(chloromethyl)-3-hydroxy-9-methyl-4,8-bis(3-methylbut-2-enoxy)-6-methylidene-4,5,6a,7,8,9,9a,9b-octahydro-3aH-azuleno[4,5-b]furan-2-one.
| Compound Name | 3-(chloromethyl)-3-hydroxy-9-methyl-4,8-bis(3-methylbut-2-enoxy)-6-methylidene-4,5,6a,7,8,9,9a,9b-octahydro-3aH-azuleno[4,5-b]furan-2-one |
|---|---|
| PubChem CID | 122648045 |
| Molecular Formula | C25H37ClO5 |
| Molecular Weight | 453.02 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | 3-(chloromethyl)-3-hydroxy-9-methyl-4,8-bis(3-methylbut-2-enoxy)-6-methylidene-4,5,6a,7,8,9,9a,9b-octahydro-3aH-azuleno[4,5-b]furan-2-one |
| SMILES | C=C1CC(OCC=C(C)C)C2C(OC(=O)C2(O)CCl)C2C1CC(OCC=C(C)C)C2C |
| InChI | InChI=1S/C25H37ClO5/c1-14(2)7-9-29-19-12-18-16(5)11-20(30-10-8-15(3)4)22-23(21(18)17(19)6)31-24(27)25(22,28)13-26/h7-8,17-23,28H,5,9-13H2,1-4,6H3 |
| InChIKey | XEVCHCGETHXIJL-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.02 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|