C21H21F2N5O4S2 — CID 122648221
N-[(2S)-1-[1,3-benzothiazol-5-yl(methyl)amino]-3-(3,5-difluorophenyl)-1-oxopropan-2-yl]-5-methyl-1,1-dioxo-1,2,5-thiadiazolidine-2-carboxamide (PubChem CID 122648221) has the molecular formula C21H21F2N5O4S2 and a molecular weight of 509.56 g/mol. Its IUPAC name is N-[(2S)-1-[1,3-benzothiazol-5-yl(methyl)amino]-3-(3,5-difluorophenyl)-1-oxopropan-2-yl]-5-methyl-1,1-dioxo-1,2,5-thiadiazolidine-2-carboxamide.
| Compound Name | N-[(2S)-1-[1,3-benzothiazol-5-yl(methyl)amino]-3-(3,5-difluorophenyl)-1-oxopropan-2-yl]-5-methyl-1,1-dioxo-1,2,5-thiadiazolidine-2-carboxamide |
|---|---|
| PubChem CID | 122648221 |
| Molecular Formula | C21H21F2N5O4S2 |
| Molecular Weight | 509.56 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | N-[(2S)-1-[1,3-benzothiazol-5-yl(methyl)amino]-3-(3,5-difluorophenyl)-1-oxopropan-2-yl]-5-methyl-1,1-dioxo-1,2,5-thiadiazolidine-2-carboxamide |
| SMILES | CN(C(=O)[C@H](Cc1cc(F)cc(F)c1)NC(=O)N1CCN(C)S1(=O)=O)c1ccc2scnc2c1 |
| InChI | InChI=1S/C21H21F2N5O4S2/c1-26-5-6-28(34(26,31)32)21(30)25-18(9-13-7-14(22)10-15(23)8-13)20(29)27(2)16-3-4-19-17(11-16)24-12-33-19/h3-4,7-8,10-12,18H,5-6,9H2,1-2H3,(H,25,30)/t18-/m0/s1 |
| InChIKey | SKFATBCAGVPJDC-SFHVURJKSA-N |
| XLogP | 2.35 |
| TPSA | 102.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.56 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |