C26H26N10O3 — CID 122648323
N-hydroxy-2-[methyl-[(9-methyl-6-morpholin-4-yl-2-quinolin-3-ylpurin-8-yl)methyl]amino]pyrimidine-5-carboxamide (PubChem CID 122648323) has the molecular formula C26H26N10O3 and a molecular weight of 526.56 g/mol. Its IUPAC name is N-hydroxy-2-[methyl-[(9-methyl-6-morpholin-4-yl-2-quinolin-3-ylpurin-8-yl)methyl]amino]pyrimidine-5-carboxamide.
| Compound Name | N-hydroxy-2-[methyl-[(9-methyl-6-morpholin-4-yl-2-quinolin-3-ylpurin-8-yl)methyl]amino]pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 122648323 |
| Molecular Formula | C26H26N10O3 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.22 |
| IUPAC Name | N-hydroxy-2-[methyl-[(9-methyl-6-morpholin-4-yl-2-quinolin-3-ylpurin-8-yl)methyl]amino]pyrimidine-5-carboxamide |
| SMILES | CN(Cc1nc2c(N3CCOCC3)nc(-c3cnc4ccccc4c3)nc2n1C)c1ncc(C(=O)NO)cn1 |
| InChI | InChI=1S/C26H26N10O3/c1-34(26-28-13-18(14-29-26)25(37)33-38)15-20-30-21-23(35(20)2)31-22(32-24(21)36-7-9-39-10-8-36)17-11-16-5-3-4-6-19(16)27-12-17/h3-6,11-14,38H,7-10,15H2,1-2H3,(H,33,37) |
| InChIKey | FRPKYYIEENVXNJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 147.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|