C24H17F2N5O — CID 122648606
4-[[2,6-difluoro-4-(2-methylindazol-4-yl)phenyl]methyl]-1,4,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-one (PubChem CID 122648606) has the molecular formula C24H17F2N5O and a molecular weight of 429.43 g/mol. Its IUPAC name is 4-[[2,6-difluoro-4-(2-methylindazol-4-yl)phenyl]methyl]-1,4,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-one.
| Compound Name | 4-[[2,6-difluoro-4-(2-methylindazol-4-yl)phenyl]methyl]-1,4,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-one |
|---|---|
| PubChem CID | 122648606 |
| Molecular Formula | C24H17F2N5O |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 4-[[2,6-difluoro-4-(2-methylindazol-4-yl)phenyl]methyl]-1,4,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-one |
| SMILES | Cn1cc2c(-c3cc(F)c(CN4Cc5ccc6nccn6c5C4=O)c(F)c3)cccc2n1 |
| InChI | InChI=1S/C24H17F2N5O/c1-29-12-17-16(3-2-4-21(17)28-29)15-9-19(25)18(20(26)10-15)13-30-11-14-5-6-22-27-7-8-31(22)23(14)24(30)32/h2-10,12H,11,13H2,1H3 |
| InChIKey | KONRPFSVKDAZQU-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |