C24H18FN5O — CID 122648613
4-[[2-fluoro-4-(2-methylindazol-5-yl)phenyl]methyl]-1,4,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-one (PubChem CID 122648613) has the molecular formula C24H18FN5O and a molecular weight of 411.44 g/mol. Its IUPAC name is 4-[[2-fluoro-4-(2-methylindazol-5-yl)phenyl]methyl]-1,4,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-one.
| Compound Name | 4-[[2-fluoro-4-(2-methylindazol-5-yl)phenyl]methyl]-1,4,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-one |
|---|---|
| PubChem CID | 122648613 |
| Molecular Formula | C24H18FN5O |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 411.15 |
| IUPAC Name | 4-[[2-fluoro-4-(2-methylindazol-5-yl)phenyl]methyl]-1,4,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-one |
| SMILES | Cn1cc2cc(-c3ccc(CN4Cc5ccc6nccn6c5C4=O)c(F)c3)ccc2n1 |
| InChI | InChI=1S/C24H18FN5O/c1-28-12-19-10-15(4-6-21(19)27-28)16-2-3-17(20(25)11-16)13-29-14-18-5-7-22-26-8-9-30(22)23(18)24(29)31/h2-12H,13-14H2,1H3 |
| InChIKey | GDVYKGBXXFLHPE-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 55.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |