C18H16N4O2 — CID 122648621
N-methyl-4-[(3-oxo-1,4,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl)methyl]benzamide (PubChem CID 122648621) has the molecular formula C18H16N4O2 and a molecular weight of 320.35 g/mol. Its IUPAC name is N-methyl-4-[(3-oxo-1,4,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl)methyl]benzamide.
| Compound Name | N-methyl-4-[(3-oxo-1,4,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl)methyl]benzamide |
|---|---|
| PubChem CID | 122648621 |
| Molecular Formula | C18H16N4O2 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | N-methyl-4-[(3-oxo-1,4,10-triazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-4-yl)methyl]benzamide |
| SMILES | CNC(=O)c1ccc(CN2Cc3ccc4nccn4c3C2=O)cc1 |
| InChI | InChI=1S/C18H16N4O2/c1-19-17(23)13-4-2-12(3-5-13)10-21-11-14-6-7-15-20-8-9-22(15)16(14)18(21)24/h2-9H,10-11H2,1H3,(H,19,23) |
| InChIKey | KVZJZNYOXKRWHY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 66.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |