C21H15F2N5O2 — CID 122648636
4-[[2,6-difluoro-4-(6-methoxy-3-pyridinyl)phenyl]methyl]-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-one (PubChem CID 122648636) has the molecular formula C21H15F2N5O2 and a molecular weight of 407.38 g/mol. Its IUPAC name is 4-[[2,6-difluoro-4-(6-methoxy-3-pyridinyl)phenyl]methyl]-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-one.
| Compound Name | 4-[[2,6-difluoro-4-(6-methoxy-3-pyridinyl)phenyl]methyl]-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-one |
|---|---|
| PubChem CID | 122648636 |
| Molecular Formula | C21H15F2N5O2 |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | 4-[[2,6-difluoro-4-(6-methoxy-3-pyridinyl)phenyl]methyl]-1,4,10,11-tetrazatricyclo[7.3.0.02,6]dodeca-2(6),7,9,11-tetraen-3-one |
| SMILES | COc1ccc(-c2cc(F)c(CN3Cc4ccc5nncn5c4C3=O)c(F)c2)cn1 |
| InChI | InChI=1S/C21H15F2N5O2/c1-30-19-5-3-12(8-24-19)14-6-16(22)15(17(23)7-14)10-27-9-13-2-4-18-26-25-11-28(18)20(13)21(27)29/h2-8,11H,9-10H2,1H3 |
| InChIKey | YZRBNMJLJLQMSZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 72.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |