About ethyl 3-[2-fluoro-3,4-dimethyl-6-(thiophen-2-ylsulfonylamino)phenyl]propanoate
ethyl 3-[2-fluoro-3,4-dimethyl-6-(thiophen-2-ylsulfonylamino)phenyl]propanoate (PubChem CID 122648982) has the molecular formula C17H20FNO4S2
and a molecular weight of 385.48 g/mol. Its IUPAC name is ethyl 3-[2-fluoro-3,4-dimethyl-6-(thiophen-2-ylsulfonylamino)phenyl]propanoate.
Molecular Properties
| Compound Name | ethyl 3-[2-fluoro-3,4-dimethyl-6-(thiophen-2-ylsulfonylamino)phenyl]propanoate |
| PubChem CID | 122648982 |
| Molecular Formula | C17H20FNO4S2 |
| Molecular Weight | 385.48 g/mol |
| Exact Mass | 385.08 |
| IUPAC Name | ethyl 3-[2-fluoro-3,4-dimethyl-6-(thiophen-2-ylsulfonylamino)phenyl]propanoate |
| SMILES | CCOC(=O)CCc1c(NS(=O)(=O)c2cccs2)cc(C)c(C)c1F |
| InChI | InChI=1S/C17H20FNO4S2/c1-4-23-15(20)8-7-13-14(10-11(2)12(3)17(13)18)19-25(21,22)16-6-5-9-24-16/h5-6,9-10,19H,4,7-8H2,1-3H3 |
| InChIKey | MCDFTSCWGRPSDL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.48 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-[2-fluoro-3,4-dimethyl-6-(thiophen-2-ylsulfonylamino)phenyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[2-fluoro-3,4-dimethyl-6-(thiophen-2-ylsulfonylamino)phenyl]propanoate?
The IUPAC name of ethyl 3-[2-fluoro-3,4-dimethyl-6-(thiophen-2-ylsulfonylamino)phenyl]propanoate (CID 122648982) is ethyl 3-[2-fluoro-3,4-dimethyl-6-(thiophen-2-ylsulfonylamino)phenyl]propanoate.
What is the SMILES notation for ethyl 3-[2-fluoro-3,4-dimethyl-6-(thiophen-2-ylsulfonylamino)phenyl]propanoate?
The canonical SMILES for ethyl 3-[2-fluoro-3,4-dimethyl-6-(thiophen-2-ylsulfonylamino)phenyl]propanoate is CCOC(=O)CCc1c(NS(=O)(=O)c2cccs2)cc(C)c(C)c1F.
What is the InChIKey of ethyl 3-[2-fluoro-3,4-dimethyl-6-(thiophen-2-ylsulfonylamino)phenyl]propanoate?
The InChIKey is MCDFTSCWGRPSDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H20FNO4S2/c1-4-23-15(20)8-7-13-14(10-11(2)12(3)17(13)18)19-25(21,22)16-6-5-9-24-16/h5-6,9-10,19H,4,7-8H2,1-3H3.
What are the key properties of ethyl 3-[2-fluoro-3,4-dimethyl-6-(thiophen-2-ylsulfonylamino)phenyl]propanoate?
ethyl 3-[2-fluoro-3,4-dimethyl-6-(thiophen-2-ylsulfonylamino)phenyl]propanoate has a molecular weight of 385.48 g/mol, XLogP of 3.80, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[2-fluoro-3,4-dimethyl-6-(thiophen-2-ylsulfonylamino)phenyl]propanoate is sourced from PubChem (CID 122648982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).