About N-[4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexyl]acetamide
N-[4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexyl]acetamide (PubChem CID 122649219) has the molecular formula C20H28N2O
and a molecular weight of 312.46 g/mol. Its IUPAC name is N-[4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexyl]acetamide |
| PubChem CID | 122649219 |
| Molecular Formula | C20H28N2O |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.22 |
| IUPAC Name | N-[4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexyl]acetamide |
| SMILES | CC(=O)NC1CCC(N[C@@H]2C[C@H]2/C(C)=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C20H28N2O/c1-14(12-16-6-4-3-5-7-16)19-13-20(19)22-18-10-8-17(9-11-18)21-15(2)23/h3-7,12,17-20,22H,8-11,13H2,1-2H3,(H,21,23)/b14-12+/t17?,18?,19-,20+/m0/s1 |
| InChIKey | IJJYTQJZMDYJIJ-LVPWSRKASA-N |
| XLogP | 3.52 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexyl]acetamide?
The IUPAC name of N-[4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexyl]acetamide (CID 122649219) is N-[4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexyl]acetamide.
What is the SMILES notation for N-[4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexyl]acetamide?
The canonical SMILES for N-[4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexyl]acetamide is CC(=O)NC1CCC(N[C@@H]2C[C@H]2/C(C)=C/c2ccccc2)CC1.
What is the InChIKey of N-[4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexyl]acetamide?
The InChIKey is IJJYTQJZMDYJIJ-LVPWSRKASA-N. The full InChI is InChI=1S/C20H28N2O/c1-14(12-16-6-4-3-5-7-16)19-13-20(19)22-18-10-8-17(9-11-18)21-15(2)23/h3-7,12,17-20,22H,8-11,13H2,1-2H3,(H,21,23)/b14-12+/t17?,18?,19-,20+/m0/s1.
What are the key properties of N-[4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexyl]acetamide?
N-[4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexyl]acetamide has a molecular weight of 312.46 g/mol, XLogP of 3.52, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexyl]acetamide is sourced from PubChem (CID 122649219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).