About 4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexan-1-ol
4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexan-1-ol (PubChem CID 122649220) has the molecular formula C18H25NO
and a molecular weight of 271.40 g/mol. Its IUPAC name is 4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexan-1-ol.
Molecular Properties
| Compound Name | 4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexan-1-ol |
| PubChem CID | 122649220 |
| Molecular Formula | C18H25NO |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.19 |
| IUPAC Name | 4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexan-1-ol |
| SMILES | C/C(=C\c1ccccc1)[C@@H]1C[C@H]1NC1CCC(O)CC1 |
| InChI | InChI=1S/C18H25NO/c1-13(11-14-5-3-2-4-6-14)17-12-18(17)19-15-7-9-16(20)10-8-15/h2-6,11,15-20H,7-10,12H2,1H3/b13-11+/t15?,16?,17-,18+/m0/s1 |
| InChIKey | USWQJAGASRULPG-DPFJXYGPSA-N |
| XLogP | 3.37 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexan-1-ol?
The IUPAC name of 4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexan-1-ol (CID 122649220) is 4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexan-1-ol.
What is the SMILES notation for 4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexan-1-ol?
The canonical SMILES for 4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexan-1-ol is C/C(=C\c1ccccc1)[C@@H]1C[C@H]1NC1CCC(O)CC1.
What is the InChIKey of 4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexan-1-ol?
The InChIKey is USWQJAGASRULPG-DPFJXYGPSA-N. The full InChI is InChI=1S/C18H25NO/c1-13(11-14-5-3-2-4-6-14)17-12-18(17)19-15-7-9-16(20)10-8-15/h2-6,11,15-20H,7-10,12H2,1H3/b13-11+/t15?,16?,17-,18+/m0/s1.
What are the key properties of 4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexan-1-ol?
4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexan-1-ol has a molecular weight of 271.40 g/mol, XLogP of 3.37, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(1R,2S)-2-[(E)-1-phenylprop-1-en-2-yl]cyclopropyl]amino]cyclohexan-1-ol is sourced from PubChem (CID 122649220), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).