About [2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] N-methylcarbamate
[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] N-methylcarbamate (PubChem CID 122649557) has the molecular formula C20H22F3NO3
and a molecular weight of 381.39 g/mol. Its IUPAC name is [2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] N-methylcarbamate.
Molecular Properties
| Compound Name | [2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] N-methylcarbamate |
| PubChem CID | 122649557 |
| Molecular Formula | C20H22F3NO3 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | [2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] N-methylcarbamate |
| SMILES | CCc1cc(C)c(OCc2c(OC(=O)NC)cccc2C(F)(F)F)cc1C |
| InChI | InChI=1S/C20H22F3NO3/c1-5-14-9-13(3)18(10-12(14)2)26-11-15-16(20(21,22)23)7-6-8-17(15)27-19(25)24-4/h6-10H,5,11H2,1-4H3,(H,24,25) |
| InChIKey | RTLZQRFUMFQQFQ-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] N-methylcarbamate?
The IUPAC name of [2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] N-methylcarbamate (CID 122649557) is [2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] N-methylcarbamate.
What is the SMILES notation for [2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] N-methylcarbamate?
The canonical SMILES for [2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] N-methylcarbamate is CCc1cc(C)c(OCc2c(OC(=O)NC)cccc2C(F)(F)F)cc1C.
What is the InChIKey of [2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] N-methylcarbamate?
The InChIKey is RTLZQRFUMFQQFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22F3NO3/c1-5-14-9-13(3)18(10-12(14)2)26-11-15-16(20(21,22)23)7-6-8-17(15)27-19(25)24-4/h6-10H,5,11H2,1-4H3,(H,24,25).
What are the key properties of [2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] N-methylcarbamate?
[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] N-methylcarbamate has a molecular weight of 381.39 g/mol, XLogP of 5.18, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] N-methylcarbamate is sourced from PubChem (CID 122649557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).