About S-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] propanethioate
S-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] propanethioate (PubChem CID 122649613) has the molecular formula C21H23F3O2S
and a molecular weight of 396.47 g/mol. Its IUPAC name is S-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] propanethioate.
Molecular Properties
| Compound Name | S-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] propanethioate |
| PubChem CID | 122649613 |
| Molecular Formula | C21H23F3O2S |
| Molecular Weight | 396.47 g/mol |
| Exact Mass | 396.14 |
| IUPAC Name | S-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] propanethioate |
| SMILES | CCC(=O)Sc1cccc(C(F)(F)F)c1COc1cc(C)c(CC)cc1C |
| InChI | InChI=1S/C21H23F3O2S/c1-5-15-10-14(4)18(11-13(15)3)26-12-16-17(21(22,23)24)8-7-9-19(16)27-20(25)6-2/h7-11H,5-6,12H2,1-4H3 |
| InChIKey | DZXVWSJVCNULBH-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 396.47 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] propanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] propanethioate?
The IUPAC name of S-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] propanethioate (CID 122649613) is S-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] propanethioate.
What is the SMILES notation for S-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] propanethioate?
The canonical SMILES for S-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] propanethioate is CCC(=O)Sc1cccc(C(F)(F)F)c1COc1cc(C)c(CC)cc1C.
What is the InChIKey of S-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] propanethioate?
The InChIKey is DZXVWSJVCNULBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23F3O2S/c1-5-15-10-14(4)18(11-13(15)3)26-12-16-17(21(22,23)24)8-7-9-19(16)27-20(25)6-2/h7-11H,5-6,12H2,1-4H3.
What are the key properties of S-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] propanethioate?
S-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] propanethioate has a molecular weight of 396.47 g/mol, XLogP of 6.49, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-[2-[(4-ethyl-2,5-dimethylphenoxy)methyl]-3-(trifluoromethyl)phenyl] propanethioate is sourced from PubChem (CID 122649613), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).