C14H25NO2 — CID 122649699
(3E,5Z)-N-[(E)-but-2-enyl]-5,6-dimethoxy-N-methylhepta-3,5-dien-1-amine (PubChem CID 122649699) has the molecular formula C14H25NO2 and a molecular weight of 239.36 g/mol. Its IUPAC name is (3E,5Z)-N-[(E)-but-2-enyl]-5,6-dimethoxy-N-methylhepta-3,5-dien-1-amine.
| Compound Name | (3E,5Z)-N-[(E)-but-2-enyl]-5,6-dimethoxy-N-methylhepta-3,5-dien-1-amine |
|---|---|
| PubChem CID | 122649699 |
| Molecular Formula | C14H25NO2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | (3E,5Z)-N-[(E)-but-2-enyl]-5,6-dimethoxy-N-methylhepta-3,5-dien-1-amine |
| SMILES | C/C=C/CN(C)CC/C=C/C(OC)=C(\C)OC |
| InChI | InChI=1S/C14H25NO2/c1-6-7-11-15(3)12-9-8-10-14(17-5)13(2)16-4/h6-8,10H,9,11-12H2,1-5H3/b7-6+,10-8+,14-13- |
| InChIKey | YIQOGIRHKJRAQB-GEFSDXTASA-N |
| XLogP | 2.96 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|