About tert-butyl 6-bromo-5-(3,3-dimethylbutanoylamino)indazole-1-carboxylate
tert-butyl 6-bromo-5-(3,3-dimethylbutanoylamino)indazole-1-carboxylate (PubChem CID 122650629) has the molecular formula C18H24BrN3O3
and a molecular weight of 410.31 g/mol. Its IUPAC name is tert-butyl 6-bromo-5-(3,3-dimethylbutanoylamino)indazole-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 6-bromo-5-(3,3-dimethylbutanoylamino)indazole-1-carboxylate |
| PubChem CID | 122650629 |
| Molecular Formula | C18H24BrN3O3 |
| Molecular Weight | 410.31 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | tert-butyl 6-bromo-5-(3,3-dimethylbutanoylamino)indazole-1-carboxylate |
| SMILES | CC(C)(C)CC(=O)Nc1cc2cnn(C(=O)OC(C)(C)C)c2cc1Br |
| InChI | InChI=1S/C18H24BrN3O3/c1-17(2,3)9-15(23)21-13-7-11-10-20-22(14(11)8-12(13)19)16(24)25-18(4,5)6/h7-8,10H,9H2,1-6H3,(H,21,23) |
| InChIKey | VODLFNFGHGTFEG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.31 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl 6-bromo-5-(3,3-dimethylbutanoylamino)indazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 6-bromo-5-(3,3-dimethylbutanoylamino)indazole-1-carboxylate?
The IUPAC name of tert-butyl 6-bromo-5-(3,3-dimethylbutanoylamino)indazole-1-carboxylate (CID 122650629) is tert-butyl 6-bromo-5-(3,3-dimethylbutanoylamino)indazole-1-carboxylate.
What is the SMILES notation for tert-butyl 6-bromo-5-(3,3-dimethylbutanoylamino)indazole-1-carboxylate?
The canonical SMILES for tert-butyl 6-bromo-5-(3,3-dimethylbutanoylamino)indazole-1-carboxylate is CC(C)(C)CC(=O)Nc1cc2cnn(C(=O)OC(C)(C)C)c2cc1Br.
What is the InChIKey of tert-butyl 6-bromo-5-(3,3-dimethylbutanoylamino)indazole-1-carboxylate?
The InChIKey is VODLFNFGHGTFEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H24BrN3O3/c1-17(2,3)9-15(23)21-13-7-11-10-20-22(14(11)8-12(13)19)16(24)25-18(4,5)6/h7-8,10H,9H2,1-6H3,(H,21,23).
What are the key properties of tert-butyl 6-bromo-5-(3,3-dimethylbutanoylamino)indazole-1-carboxylate?
tert-butyl 6-bromo-5-(3,3-dimethylbutanoylamino)indazole-1-carboxylate has a molecular weight of 410.31 g/mol, XLogP of 4.96, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 6-bromo-5-(3,3-dimethylbutanoylamino)indazole-1-carboxylate is sourced from PubChem (CID 122650629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).