C17H23N5O — CID 122650707
(E)-N-ethyl-4-hydrazinylidene-3-methyl-N-[(6-methyl-3-pyridinyl)methyl]-4-(1,3-oxazol-2-yl)but-2-en-1-amine (PubChem CID 122650707) has the molecular formula C17H23N5O and a molecular weight of 313.41 g/mol. Its IUPAC name is (E)-N-ethyl-4-hydrazinylidene-3-methyl-N-[(6-methyl-3-pyridinyl)methyl]-4-(1,3-oxazol-2-yl)but-2-en-1-amine.
| Compound Name | (E)-N-ethyl-4-hydrazinylidene-3-methyl-N-[(6-methyl-3-pyridinyl)methyl]-4-(1,3-oxazol-2-yl)but-2-en-1-amine |
|---|---|
| PubChem CID | 122650707 |
| Molecular Formula | C17H23N5O |
| Molecular Weight | 313.41 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | (E)-N-ethyl-4-hydrazinylidene-3-methyl-N-[(6-methyl-3-pyridinyl)methyl]-4-(1,3-oxazol-2-yl)but-2-en-1-amine |
| SMILES | CCN(C/C=C(\C)C(=NN)c1ncco1)Cc1ccc(C)nc1 |
| InChI | InChI=1S/C17H23N5O/c1-4-22(12-15-6-5-14(3)20-11-15)9-7-13(2)16(21-18)17-19-8-10-23-17/h5-8,10-11H,4,9,12,18H2,1-3H3/b13-7+,21-16? |
| InChIKey | PWHPHGKHNIYYAU-SIWXODFCSA-N |
| XLogP | 2.51 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|