C23H22FN5O4S — CID 122650849
5-N-(2,2-dioxo-1,3-dihydro-2-benzothiophen-5-yl)-2-(4-fluoro-3-methylphenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxamide (PubChem CID 122650849) has the molecular formula C23H22FN5O4S and a molecular weight of 483.53 g/mol. Its IUPAC name is 5-N-(2,2-dioxo-1,3-dihydro-2-benzothiophen-5-yl)-2-(4-fluoro-3-methylphenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxamide.
| Compound Name | 5-N-(2,2-dioxo-1,3-dihydro-2-benzothiophen-5-yl)-2-(4-fluoro-3-methylphenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 122650849 |
| Molecular Formula | C23H22FN5O4S |
| Molecular Weight | 483.53 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 5-N-(2,2-dioxo-1,3-dihydro-2-benzothiophen-5-yl)-2-(4-fluoro-3-methylphenyl)-6,7-dihydro-4H-pyrazolo[1,5-a]pyrazine-3,5-dicarboxamide |
| SMILES | Cc1cc(-c2nn3c(c2C(N)=O)CN(C(=O)Nc2ccc4c(c2)CS(=O)(=O)C4)CC3)ccc1F |
| InChI | InChI=1S/C23H22FN5O4S/c1-13-8-14(3-5-18(13)24)21-20(22(25)30)19-10-28(6-7-29(19)27-21)23(31)26-17-4-2-15-11-34(32,33)12-16(15)9-17/h2-5,8-9H,6-7,10-12H2,1H3,(H2,25,30)(H,26,31) |
| InChIKey | PSVUAKNNIWWSOO-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 127.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.53 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |