C7H15F3N2O2S — CID 122651177
2-ethylsulfonyl-4,4,4-trifluoro-1-N-methylbutane-1,3-diamine (PubChem CID 122651177) has the molecular formula C7H15F3N2O2S and a molecular weight of 248.27 g/mol. Its IUPAC name is 2-ethylsulfonyl-4,4,4-trifluoro-1-N-methylbutane-1,3-diamine.
| Compound Name | 2-ethylsulfonyl-4,4,4-trifluoro-1-N-methylbutane-1,3-diamine |
|---|---|
| PubChem CID | 122651177 |
| Molecular Formula | C7H15F3N2O2S |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 2-ethylsulfonyl-4,4,4-trifluoro-1-N-methylbutane-1,3-diamine |
| SMILES | CCS(=O)(=O)C(CNC)C(N)C(F)(F)F |
| InChI | InChI=1S/C7H15F3N2O2S/c1-3-15(13,14)5(4-12-2)6(11)7(8,9)10/h5-6,12H,3-4,11H2,1-2H3 |
| InChIKey | XGUAEAMAIQWIDH-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |