C16H31N3O4S — CID 122651412
N-[4-[[(8R,10S)-10-(methoxymethyl)-1,6-diazabicyclo[6.2.0]decan-6-yl]sulfonyl]butyl]acetamide (PubChem CID 122651412) has the molecular formula C16H31N3O4S and a molecular weight of 361.51 g/mol. Its IUPAC name is N-[4-[[(8R,10S)-10-(methoxymethyl)-1,6-diazabicyclo[6.2.0]decan-6-yl]sulfonyl]butyl]acetamide.
| Compound Name | N-[4-[[(8R,10S)-10-(methoxymethyl)-1,6-diazabicyclo[6.2.0]decan-6-yl]sulfonyl]butyl]acetamide |
|---|---|
| PubChem CID | 122651412 |
| Molecular Formula | C16H31N3O4S |
| Molecular Weight | 361.51 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | N-[4-[[(8R,10S)-10-(methoxymethyl)-1,6-diazabicyclo[6.2.0]decan-6-yl]sulfonyl]butyl]acetamide |
| SMILES | COC[C@@H]1C[C@@H]2CN(S(=O)(=O)CCCCNC(C)=O)CCCCN12 |
| InChI | InChI=1S/C16H31N3O4S/c1-14(20)17-7-3-6-10-24(21,22)18-8-4-5-9-19-15(12-18)11-16(19)13-23-2/h15-16H,3-13H2,1-2H3,(H,17,20)/t15-,16+/m1/s1 |
| InChIKey | USENOWKUSLMIRR-CVEARBPZSA-N |
| XLogP | 0.42 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.51 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|