C28H47NO11S2 — CID 122651911
S-[[4-[2-[bis[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]ethoxy]-2-(2-methylpropanoylsulfanylmethyl)phenyl]methyl] 2-methylpropanethioate (PubChem CID 122651911) has the molecular formula C28H47NO11S2 and a molecular weight of 637.81 g/mol. Its IUPAC name is S-[[4-[2-[bis[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]ethoxy]-2-(2-methylpropanoylsulfanylmethyl)phenyl]methyl] 2-methylpropanethioate.
| Compound Name | S-[[4-[2-[bis[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]ethoxy]-2-(2-methylpropanoylsulfanylmethyl)phenyl]methyl] 2-methylpropanethioate |
|---|---|
| PubChem CID | 122651911 |
| Molecular Formula | C28H47NO11S2 |
| Molecular Weight | 637.81 g/mol |
| Exact Mass | 637.26 |
| IUPAC Name | S-[[4-[2-[bis[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]ethoxy]-2-(2-methylpropanoylsulfanylmethyl)phenyl]methyl] 2-methylpropanethioate |
| SMILES | CC(C)C(=O)SCc1ccc(OCCN(C[C@H](O)[C@H](O)[C@H](O)CO)C[C@H](O)[C@H](O)[C@H](O)CO)cc1CSC(=O)C(C)C |
| InChI | InChI=1S/C28H47NO11S2/c1-16(2)27(38)41-14-18-5-6-20(9-19(18)15-42-28(39)17(3)4)40-8-7-29(10-21(32)25(36)23(34)12-30)11-22(33)26(37)24(35)13-31/h5-6,9,16-17,21-26,30-37H,7-8,10-15H2,1-4H3/t21-,22-,23+,24+,25-,26-/m0/s1 |
| InChIKey | GDCVRMUCKMNZKM-QCVMBYIASA-N |
| XLogP | -0.65 |
| TPSA | 208.45 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.81 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|