C20H35NO9S2 — CID 122651922
(2R,3S,4R)-5-[2-[3,4-bis(sulfanylmethyl)phenoxy]ethyl-[(2R,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]pentane-1,2,3,4-tetrol (PubChem CID 122651922) has the molecular formula C20H35NO9S2 and a molecular weight of 497.63 g/mol. Its IUPAC name is (2R,3S,4R)-5-[2-[3,4-bis(sulfanylmethyl)phenoxy]ethyl-[(2R,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]pentane-1,2,3,4-tetrol.
| Compound Name | (2R,3S,4R)-5-[2-[3,4-bis(sulfanylmethyl)phenoxy]ethyl-[(2R,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]pentane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 122651922 |
| Molecular Formula | C20H35NO9S2 |
| Molecular Weight | 497.63 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | (2R,3S,4R)-5-[2-[3,4-bis(sulfanylmethyl)phenoxy]ethyl-[(2R,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]pentane-1,2,3,4-tetrol |
| SMILES | OC[C@@H](O)[C@@H](O)[C@H](O)CN(CCOc1ccc(CS)c(CS)c1)C[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C20H35NO9S2/c22-8-17(26)19(28)15(24)6-21(7-16(25)20(29)18(27)9-23)3-4-30-14-2-1-12(10-31)13(5-14)11-32/h1-2,5,15-20,22-29,31-32H,3-4,6-11H2/t15-,16-,17-,18-,19+,20+/m1/s1 |
| InChIKey | FKCMXFJZBCWFOB-YRYYUTHUSA-N |
| XLogP | -2.62 |
| TPSA | 174.31 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.63 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|