About 7-[(3-fluorophenyl)methyl]-3-(4-methoxyoxan-4-yl)-6-methylimidazo[1,5-a]pyrazin-8-one
7-[(3-fluorophenyl)methyl]-3-(4-methoxyoxan-4-yl)-6-methylimidazo[1,5-a]pyrazin-8-one (PubChem CID 122652291) has the molecular formula C20H22FN3O3
and a molecular weight of 371.41 g/mol. Its IUPAC name is 7-[(3-fluorophenyl)methyl]-3-(4-methoxyoxan-4-yl)-6-methylimidazo[1,5-a]pyrazin-8-one.
Molecular Properties
| Compound Name | 7-[(3-fluorophenyl)methyl]-3-(4-methoxyoxan-4-yl)-6-methylimidazo[1,5-a]pyrazin-8-one |
| PubChem CID | 122652291 |
| Molecular Formula | C20H22FN3O3 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | 7-[(3-fluorophenyl)methyl]-3-(4-methoxyoxan-4-yl)-6-methylimidazo[1,5-a]pyrazin-8-one |
| SMILES | COC1(c2ncc3c(=O)n(Cc4cccc(F)c4)c(C)cn23)CCOCC1 |
| InChI | InChI=1S/C20H22FN3O3/c1-14-12-24-17(11-22-19(24)20(26-2)6-8-27-9-7-20)18(25)23(14)13-15-4-3-5-16(21)10-15/h3-5,10-12H,6-9,13H2,1-2H3 |
| InChIKey | ZCVGFCXGAGKYHH-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 57.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 7-[(3-fluorophenyl)methyl]-3-(4-methoxyoxan-4-yl)-6-methylimidazo[1,5-a]pyrazin-8-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-[(3-fluorophenyl)methyl]-3-(4-methoxyoxan-4-yl)-6-methylimidazo[1,5-a]pyrazin-8-one?
The IUPAC name of 7-[(3-fluorophenyl)methyl]-3-(4-methoxyoxan-4-yl)-6-methylimidazo[1,5-a]pyrazin-8-one (CID 122652291) is 7-[(3-fluorophenyl)methyl]-3-(4-methoxyoxan-4-yl)-6-methylimidazo[1,5-a]pyrazin-8-one.
What is the SMILES notation for 7-[(3-fluorophenyl)methyl]-3-(4-methoxyoxan-4-yl)-6-methylimidazo[1,5-a]pyrazin-8-one?
The canonical SMILES for 7-[(3-fluorophenyl)methyl]-3-(4-methoxyoxan-4-yl)-6-methylimidazo[1,5-a]pyrazin-8-one is COC1(c2ncc3c(=O)n(Cc4cccc(F)c4)c(C)cn23)CCOCC1.
What is the InChIKey of 7-[(3-fluorophenyl)methyl]-3-(4-methoxyoxan-4-yl)-6-methylimidazo[1,5-a]pyrazin-8-one?
The InChIKey is ZCVGFCXGAGKYHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22FN3O3/c1-14-12-24-17(11-22-19(24)20(26-2)6-8-27-9-7-20)18(25)23(14)13-15-4-3-5-16(21)10-15/h3-5,10-12H,6-9,13H2,1-2H3.
What are the key properties of 7-[(3-fluorophenyl)methyl]-3-(4-methoxyoxan-4-yl)-6-methylimidazo[1,5-a]pyrazin-8-one?
7-[(3-fluorophenyl)methyl]-3-(4-methoxyoxan-4-yl)-6-methylimidazo[1,5-a]pyrazin-8-one has a molecular weight of 371.41 g/mol, XLogP of 2.64, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-[(3-fluorophenyl)methyl]-3-(4-methoxyoxan-4-yl)-6-methylimidazo[1,5-a]pyrazin-8-one is sourced from PubChem (CID 122652291), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).