C17H11F2NO4S2 — CID 122652900
3-[5-(2,6-difluoro-3-hydroxybenzoyl)thiophen-2-yl]benzenesulfonamide (PubChem CID 122652900) has the molecular formula C17H11F2NO4S2 and a molecular weight of 395.41 g/mol. Its IUPAC name is 3-[5-(2,6-difluoro-3-hydroxybenzoyl)thiophen-2-yl]benzenesulfonamide.
| Compound Name | 3-[5-(2,6-difluoro-3-hydroxybenzoyl)thiophen-2-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 122652900 |
| Molecular Formula | C17H11F2NO4S2 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.01 |
| IUPAC Name | 3-[5-(2,6-difluoro-3-hydroxybenzoyl)thiophen-2-yl]benzenesulfonamide |
| SMILES | NS(=O)(=O)c1cccc(-c2ccc(C(=O)c3c(F)ccc(O)c3F)s2)c1 |
| InChI | InChI=1S/C17H11F2NO4S2/c18-11-4-5-12(21)16(19)15(11)17(22)14-7-6-13(25-14)9-2-1-3-10(8-9)26(20,23)24/h1-8,21H,(H2,20,23,24) |
| InChIKey | ITOJSNQMABUYST-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |