C17H7F5O2S — CID 122652926
[5-(2,4-difluorophenyl)thiophen-2-yl]-(2,4,5-trifluoro-3-hydroxyphenyl)methanone (PubChem CID 122652926) has the molecular formula C17H7F5O2S and a molecular weight of 370.30 g/mol. Its IUPAC name is [5-(2,4-difluorophenyl)thiophen-2-yl]-(2,4,5-trifluoro-3-hydroxyphenyl)methanone.
| Compound Name | [5-(2,4-difluorophenyl)thiophen-2-yl]-(2,4,5-trifluoro-3-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 122652926 |
| Molecular Formula | C17H7F5O2S |
| Molecular Weight | 370.30 g/mol |
| Exact Mass | 370.01 |
| IUPAC Name | [5-(2,4-difluorophenyl)thiophen-2-yl]-(2,4,5-trifluoro-3-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(-c2ccc(F)cc2F)s1)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C17H7F5O2S/c18-7-1-2-8(10(19)5-7)12-3-4-13(25-12)16(23)9-6-11(20)15(22)17(24)14(9)21/h1-6,24H |
| InChIKey | QVHCDCUIBFYPSB-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.30 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|