About N-[4-[5-(2,4,5-trifluoro-3-hydroxybenzoyl)thiophen-2-yl]phenyl]acetamide
N-[4-[5-(2,4,5-trifluoro-3-hydroxybenzoyl)thiophen-2-yl]phenyl]acetamide (PubChem CID 122652956) has the molecular formula C19H12F3NO3S
and a molecular weight of 391.37 g/mol. Its IUPAC name is N-[4-[5-(2,4,5-trifluoro-3-hydroxybenzoyl)thiophen-2-yl]phenyl]acetamide.
Molecular Properties
| Compound Name | N-[4-[5-(2,4,5-trifluoro-3-hydroxybenzoyl)thiophen-2-yl]phenyl]acetamide |
| PubChem CID | 122652956 |
| Molecular Formula | C19H12F3NO3S |
| Molecular Weight | 391.37 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | N-[4-[5-(2,4,5-trifluoro-3-hydroxybenzoyl)thiophen-2-yl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(-c2ccc(C(=O)c3cc(F)c(F)c(O)c3F)s2)cc1 |
| InChI | InChI=1S/C19H12F3NO3S/c1-9(24)23-11-4-2-10(3-5-11)14-6-7-15(27-14)18(25)12-8-13(20)17(22)19(26)16(12)21/h2-8,26H,1H3,(H,23,24) |
| InChIKey | LSADLVAUCGWXQD-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.37 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze N-[4-[5-(2,4,5-trifluoro-3-hydroxybenzoyl)thiophen-2-yl]phenyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-[5-(2,4,5-trifluoro-3-hydroxybenzoyl)thiophen-2-yl]phenyl]acetamide?
The IUPAC name of N-[4-[5-(2,4,5-trifluoro-3-hydroxybenzoyl)thiophen-2-yl]phenyl]acetamide (CID 122652956) is N-[4-[5-(2,4,5-trifluoro-3-hydroxybenzoyl)thiophen-2-yl]phenyl]acetamide.
What is the SMILES notation for N-[4-[5-(2,4,5-trifluoro-3-hydroxybenzoyl)thiophen-2-yl]phenyl]acetamide?
The canonical SMILES for N-[4-[5-(2,4,5-trifluoro-3-hydroxybenzoyl)thiophen-2-yl]phenyl]acetamide is CC(=O)Nc1ccc(-c2ccc(C(=O)c3cc(F)c(F)c(O)c3F)s2)cc1.
What is the InChIKey of N-[4-[5-(2,4,5-trifluoro-3-hydroxybenzoyl)thiophen-2-yl]phenyl]acetamide?
The InChIKey is LSADLVAUCGWXQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H12F3NO3S/c1-9(24)23-11-4-2-10(3-5-11)14-6-7-15(27-14)18(25)12-8-13(20)17(22)19(26)16(12)21/h2-8,26H,1H3,(H,23,24).
What are the key properties of N-[4-[5-(2,4,5-trifluoro-3-hydroxybenzoyl)thiophen-2-yl]phenyl]acetamide?
N-[4-[5-(2,4,5-trifluoro-3-hydroxybenzoyl)thiophen-2-yl]phenyl]acetamide has a molecular weight of 391.37 g/mol, XLogP of 4.73, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-[5-(2,4,5-trifluoro-3-hydroxybenzoyl)thiophen-2-yl]phenyl]acetamide is sourced from PubChem (CID 122652956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).