About [4-[5-(2,4,5-trifluoro-3-methoxybenzoyl)thiophen-2-yl]phenyl] sulfamate
[4-[5-(2,4,5-trifluoro-3-methoxybenzoyl)thiophen-2-yl]phenyl] sulfamate (PubChem CID 122652978) has the molecular formula C18H12F3NO5S2
and a molecular weight of 443.42 g/mol. Its IUPAC name is [4-[5-(2,4,5-trifluoro-3-methoxybenzoyl)thiophen-2-yl]phenyl] sulfamate.
Molecular Properties
| Compound Name | [4-[5-(2,4,5-trifluoro-3-methoxybenzoyl)thiophen-2-yl]phenyl] sulfamate |
| PubChem CID | 122652978 |
| Molecular Formula | C18H12F3NO5S2 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | [4-[5-(2,4,5-trifluoro-3-methoxybenzoyl)thiophen-2-yl]phenyl] sulfamate |
| SMILES | COc1c(F)c(F)cc(C(=O)c2ccc(-c3ccc(OS(N)(=O)=O)cc3)s2)c1F |
| InChI | InChI=1S/C18H12F3NO5S2/c1-26-18-15(20)11(8-12(19)16(18)21)17(23)14-7-6-13(28-14)9-2-4-10(5-3-9)27-29(22,24)25/h2-8H,1H3,(H2,22,24,25) |
| InChIKey | NNRJJLQRISMYKI-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 95.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze [4-[5-(2,4,5-trifluoro-3-methoxybenzoyl)thiophen-2-yl]phenyl] sulfamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[5-(2,4,5-trifluoro-3-methoxybenzoyl)thiophen-2-yl]phenyl] sulfamate?
The IUPAC name of [4-[5-(2,4,5-trifluoro-3-methoxybenzoyl)thiophen-2-yl]phenyl] sulfamate (CID 122652978) is [4-[5-(2,4,5-trifluoro-3-methoxybenzoyl)thiophen-2-yl]phenyl] sulfamate.
What is the SMILES notation for [4-[5-(2,4,5-trifluoro-3-methoxybenzoyl)thiophen-2-yl]phenyl] sulfamate?
The canonical SMILES for [4-[5-(2,4,5-trifluoro-3-methoxybenzoyl)thiophen-2-yl]phenyl] sulfamate is COc1c(F)c(F)cc(C(=O)c2ccc(-c3ccc(OS(N)(=O)=O)cc3)s2)c1F.
What is the InChIKey of [4-[5-(2,4,5-trifluoro-3-methoxybenzoyl)thiophen-2-yl]phenyl] sulfamate?
The InChIKey is NNRJJLQRISMYKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12F3NO5S2/c1-26-18-15(20)11(8-12(19)16(18)21)17(23)14-7-6-13(28-14)9-2-4-10(5-3-9)27-29(22,24)25/h2-8H,1H3,(H2,22,24,25).
What are the key properties of [4-[5-(2,4,5-trifluoro-3-methoxybenzoyl)thiophen-2-yl]phenyl] sulfamate?
[4-[5-(2,4,5-trifluoro-3-methoxybenzoyl)thiophen-2-yl]phenyl] sulfamate has a molecular weight of 443.42 g/mol, XLogP of 3.65, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[5-(2,4,5-trifluoro-3-methoxybenzoyl)thiophen-2-yl]phenyl] sulfamate is sourced from PubChem (CID 122652978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).