C17H7Cl2F3O3S — CID 122652981
[5-(3,5-dichloro-4-hydroxyphenyl)thiophen-2-yl]-(2,4,5-trifluoro-3-hydroxyphenyl)methanone (PubChem CID 122652981) has the molecular formula C17H7Cl2F3O3S and a molecular weight of 419.21 g/mol. Its IUPAC name is [5-(3,5-dichloro-4-hydroxyphenyl)thiophen-2-yl]-(2,4,5-trifluoro-3-hydroxyphenyl)methanone.
| Compound Name | [5-(3,5-dichloro-4-hydroxyphenyl)thiophen-2-yl]-(2,4,5-trifluoro-3-hydroxyphenyl)methanone |
|---|---|
| PubChem CID | 122652981 |
| Molecular Formula | C17H7Cl2F3O3S |
| Molecular Weight | 419.21 g/mol |
| Exact Mass | 417.94 |
| IUPAC Name | [5-(3,5-dichloro-4-hydroxyphenyl)thiophen-2-yl]-(2,4,5-trifluoro-3-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(-c2cc(Cl)c(O)c(Cl)c2)s1)c1cc(F)c(F)c(O)c1F |
| InChI | InChI=1S/C17H7Cl2F3O3S/c18-8-3-6(4-9(19)16(8)24)11-1-2-12(26-11)15(23)7-5-10(20)14(22)17(25)13(7)21/h1-5,24-25H |
| InChIKey | HCUFSJFBLVAVGG-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.21 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|