About (3-ethoxy-2,6-difluorophenyl)-(5-pyridin-4-ylthiophen-2-yl)methanone
(3-ethoxy-2,6-difluorophenyl)-(5-pyridin-4-ylthiophen-2-yl)methanone (PubChem CID 122652984) has the molecular formula C18H13F2NO2S
and a molecular weight of 345.37 g/mol. Its IUPAC name is (3-ethoxy-2,6-difluorophenyl)-(5-pyridin-4-ylthiophen-2-yl)methanone.
Molecular Properties
| Compound Name | (3-ethoxy-2,6-difluorophenyl)-(5-pyridin-4-ylthiophen-2-yl)methanone |
| PubChem CID | 122652984 |
| Molecular Formula | C18H13F2NO2S |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | (3-ethoxy-2,6-difluorophenyl)-(5-pyridin-4-ylthiophen-2-yl)methanone |
| SMILES | CCOc1ccc(F)c(C(=O)c2ccc(-c3ccncc3)s2)c1F |
| InChI | InChI=1S/C18H13F2NO2S/c1-2-23-13-4-3-12(19)16(17(13)20)18(22)15-6-5-14(24-15)11-7-9-21-10-8-11/h3-10H,2H2,1H3 |
| InChIKey | BPVQPBUIBBKKAV-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (3-ethoxy-2,6-difluorophenyl)-(5-pyridin-4-ylthiophen-2-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-ethoxy-2,6-difluorophenyl)-(5-pyridin-4-ylthiophen-2-yl)methanone?
The IUPAC name of (3-ethoxy-2,6-difluorophenyl)-(5-pyridin-4-ylthiophen-2-yl)methanone (CID 122652984) is (3-ethoxy-2,6-difluorophenyl)-(5-pyridin-4-ylthiophen-2-yl)methanone.
What is the SMILES notation for (3-ethoxy-2,6-difluorophenyl)-(5-pyridin-4-ylthiophen-2-yl)methanone?
The canonical SMILES for (3-ethoxy-2,6-difluorophenyl)-(5-pyridin-4-ylthiophen-2-yl)methanone is CCOc1ccc(F)c(C(=O)c2ccc(-c3ccncc3)s2)c1F.
What is the InChIKey of (3-ethoxy-2,6-difluorophenyl)-(5-pyridin-4-ylthiophen-2-yl)methanone?
The InChIKey is BPVQPBUIBBKKAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F2NO2S/c1-2-23-13-4-3-12(19)16(17(13)20)18(22)15-6-5-14(24-15)11-7-9-21-10-8-11/h3-10H,2H2,1H3.
What are the key properties of (3-ethoxy-2,6-difluorophenyl)-(5-pyridin-4-ylthiophen-2-yl)methanone?
(3-ethoxy-2,6-difluorophenyl)-(5-pyridin-4-ylthiophen-2-yl)methanone has a molecular weight of 345.37 g/mol, XLogP of 4.72, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-ethoxy-2,6-difluorophenyl)-(5-pyridin-4-ylthiophen-2-yl)methanone is sourced from PubChem (CID 122652984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).