C28H33NO6 — CID 122653070
1-[1,3-bis(phenylmethoxy)propan-2-yloxy]-5-tert-butyl-2-methoxy-3-nitrobenzene (PubChem CID 122653070) has the molecular formula C28H33NO6 and a molecular weight of 479.57 g/mol. Its IUPAC name is 1-[1,3-bis(phenylmethoxy)propan-2-yloxy]-5-tert-butyl-2-methoxy-3-nitrobenzene.
| Compound Name | 1-[1,3-bis(phenylmethoxy)propan-2-yloxy]-5-tert-butyl-2-methoxy-3-nitrobenzene |
|---|---|
| PubChem CID | 122653070 |
| Molecular Formula | C28H33NO6 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | 1-[1,3-bis(phenylmethoxy)propan-2-yloxy]-5-tert-butyl-2-methoxy-3-nitrobenzene |
| SMILES | COc1c(OC(COCc2ccccc2)COCc2ccccc2)cc(C(C)(C)C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C28H33NO6/c1-28(2,3)23-15-25(29(30)31)27(32-4)26(16-23)35-24(19-33-17-21-11-7-5-8-12-21)20-34-18-22-13-9-6-10-14-22/h5-16,24H,17-20H2,1-4H3 |
| InChIKey | YXWCUPHWAIEWHZ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|