C25H21F3N4O2 — CID 122653558
N-[(3S)-2-oxopyrrolidin-3-yl]-1-[2-[(3,4,5-trifluorophenyl)methyl]-4-pyridinyl]-2,3-dihydroindole-4-carboxamide (PubChem CID 122653558) has the molecular formula C25H21F3N4O2 and a molecular weight of 466.46 g/mol. Its IUPAC name is N-[(3S)-2-oxopyrrolidin-3-yl]-1-[2-[(3,4,5-trifluorophenyl)methyl]-4-pyridinyl]-2,3-dihydroindole-4-carboxamide.
| Compound Name | N-[(3S)-2-oxopyrrolidin-3-yl]-1-[2-[(3,4,5-trifluorophenyl)methyl]-4-pyridinyl]-2,3-dihydroindole-4-carboxamide |
|---|---|
| PubChem CID | 122653558 |
| Molecular Formula | C25H21F3N4O2 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.16 |
| IUPAC Name | N-[(3S)-2-oxopyrrolidin-3-yl]-1-[2-[(3,4,5-trifluorophenyl)methyl]-4-pyridinyl]-2,3-dihydroindole-4-carboxamide |
| SMILES | O=C(N[C@H]1CCNC1=O)c1cccc2c1CCN2c1ccnc(Cc2cc(F)c(F)c(F)c2)c1 |
| InChI | InChI=1S/C25H21F3N4O2/c26-19-11-14(12-20(27)23(19)28)10-15-13-16(4-7-29-15)32-9-6-17-18(2-1-3-22(17)32)24(33)31-21-5-8-30-25(21)34/h1-4,7,11-13,21H,5-6,8-10H2,(H,30,34)(H,31,33)/t21-/m0/s1 |
| InChIKey | NZOSDYGJUIBTGI-NRFANRHFSA-N |
| XLogP | 3.40 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|