About 3-(7-chloro-1H-indazol-5-yl)-2-cyclobutyl-5-(trifluoromethyl)imidazo[4,5-b]pyridine
3-(7-chloro-1H-indazol-5-yl)-2-cyclobutyl-5-(trifluoromethyl)imidazo[4,5-b]pyridine (PubChem CID 122654684) has the molecular formula C18H13ClF3N5
and a molecular weight of 391.78 g/mol. Its IUPAC name is 3-(7-chloro-1H-indazol-5-yl)-2-cyclobutyl-5-(trifluoromethyl)imidazo[4,5-b]pyridine.
Molecular Properties
| Compound Name | 3-(7-chloro-1H-indazol-5-yl)-2-cyclobutyl-5-(trifluoromethyl)imidazo[4,5-b]pyridine |
| PubChem CID | 122654684 |
| Molecular Formula | C18H13ClF3N5 |
| Molecular Weight | 391.78 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 3-(7-chloro-1H-indazol-5-yl)-2-cyclobutyl-5-(trifluoromethyl)imidazo[4,5-b]pyridine |
| SMILES | FC(F)(F)c1ccc2nc(C3CCC3)n(-c3cc(Cl)c4[nH]ncc4c3)c2n1 |
| InChI | InChI=1S/C18H13ClF3N5/c19-12-7-11(6-10-8-23-26-15(10)12)27-16(9-2-1-3-9)24-13-4-5-14(18(20,21)22)25-17(13)27/h4-9H,1-3H2,(H,23,26) |
| InChIKey | NJXDKPUROBXJKW-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.78 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(7-chloro-1H-indazol-5-yl)-2-cyclobutyl-5-(trifluoromethyl)imidazo[4,5-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(7-chloro-1H-indazol-5-yl)-2-cyclobutyl-5-(trifluoromethyl)imidazo[4,5-b]pyridine?
The IUPAC name of 3-(7-chloro-1H-indazol-5-yl)-2-cyclobutyl-5-(trifluoromethyl)imidazo[4,5-b]pyridine (CID 122654684) is 3-(7-chloro-1H-indazol-5-yl)-2-cyclobutyl-5-(trifluoromethyl)imidazo[4,5-b]pyridine.
What is the SMILES notation for 3-(7-chloro-1H-indazol-5-yl)-2-cyclobutyl-5-(trifluoromethyl)imidazo[4,5-b]pyridine?
The canonical SMILES for 3-(7-chloro-1H-indazol-5-yl)-2-cyclobutyl-5-(trifluoromethyl)imidazo[4,5-b]pyridine is FC(F)(F)c1ccc2nc(C3CCC3)n(-c3cc(Cl)c4[nH]ncc4c3)c2n1.
What is the InChIKey of 3-(7-chloro-1H-indazol-5-yl)-2-cyclobutyl-5-(trifluoromethyl)imidazo[4,5-b]pyridine?
The InChIKey is NJXDKPUROBXJKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13ClF3N5/c19-12-7-11(6-10-8-23-26-15(10)12)27-16(9-2-1-3-9)24-13-4-5-14(18(20,21)22)25-17(13)27/h4-9H,1-3H2,(H,23,26).
What are the key properties of 3-(7-chloro-1H-indazol-5-yl)-2-cyclobutyl-5-(trifluoromethyl)imidazo[4,5-b]pyridine?
3-(7-chloro-1H-indazol-5-yl)-2-cyclobutyl-5-(trifluoromethyl)imidazo[4,5-b]pyridine has a molecular weight of 391.78 g/mol, XLogP of 5.24, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(7-chloro-1H-indazol-5-yl)-2-cyclobutyl-5-(trifluoromethyl)imidazo[4,5-b]pyridine is sourced from PubChem (CID 122654684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).